C22H34O3 — CID 54040919
[(1R,2S)-2-(2-butan-2-yloxyphenyl)cyclohexyl] hexanoate (PubChem CID 54040919) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(1R,2S)-2-(2-butan-2-yloxyphenyl)cyclohexyl] hexanoate.
| Compound Name | [(1R,2S)-2-(2-butan-2-yloxyphenyl)cyclohexyl] hexanoate |
|---|---|
| PubChem CID | 54040919 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(1R,2S)-2-(2-butan-2-yloxyphenyl)cyclohexyl] hexanoate |
| SMILES | CCCCCC(=O)O[C@@H]1CCCC[C@H]1c1ccccc1OC(C)CC |
| InChI | InChI=1S/C22H34O3/c1-4-6-7-16-22(23)25-21-15-11-9-13-19(21)18-12-8-10-14-20(18)24-17(3)5-2/h8,10,12,14,17,19,21H,4-7,9,11,13,15-16H2,1-3H3/t17?,19-,21+/m0/s1 |
| InChIKey | LMGUSBYWPJWOSA-QJUSXVFHSA-N |
| XLogP | 6.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|