C25H32O3 — CID 54283260
[(1R,2S)-2-(3-phenylmethoxyphenyl)cyclohexyl] hexanoate (PubChem CID 54283260) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is [(1R,2S)-2-(3-phenylmethoxyphenyl)cyclohexyl] hexanoate.
| Compound Name | [(1R,2S)-2-(3-phenylmethoxyphenyl)cyclohexyl] hexanoate |
|---|---|
| PubChem CID | 54283260 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | [(1R,2S)-2-(3-phenylmethoxyphenyl)cyclohexyl] hexanoate |
| SMILES | CCCCCC(=O)O[C@@H]1CCCC[C@H]1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H32O3/c1-2-3-5-17-25(26)28-24-16-9-8-15-23(24)21-13-10-14-22(18-21)27-19-20-11-6-4-7-12-20/h4,6-7,10-14,18,23-24H,2-3,5,8-9,15-17,19H2,1H3/t23-,24+/m0/s1 |
| InChIKey | RSHIGLSIWMWXAB-BJKOFHAPSA-N |
| XLogP | 6.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|