C33H36O3 — CID 57021380
[(1S,2R)-2-[3-(anthracen-9-ylmethoxy)phenyl]cyclohexyl] hexanoate (PubChem CID 57021380) has the molecular formula C33H36O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is [(1S,2R)-2-[3-(anthracen-9-ylmethoxy)phenyl]cyclohexyl] hexanoate.
| Compound Name | [(1S,2R)-2-[3-(anthracen-9-ylmethoxy)phenyl]cyclohexyl] hexanoate |
|---|---|
| PubChem CID | 57021380 |
| Molecular Formula | C33H36O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | [(1S,2R)-2-[3-(anthracen-9-ylmethoxy)phenyl]cyclohexyl] hexanoate |
| SMILES | CCCCCC(=O)O[C@H]1CCCC[C@@H]1c1cccc(OCc2c3ccccc3cc3ccccc23)c1 |
| InChI | InChI=1S/C33H36O3/c1-2-3-4-20-33(34)36-32-19-10-9-18-30(32)26-14-11-15-27(22-26)35-23-31-28-16-7-5-12-24(28)21-25-13-6-8-17-29(25)31/h5-8,11-17,21-22,30,32H,2-4,9-10,18-20,23H2,1H3/t30-,32+/m1/s1 |
| InChIKey | NJOPOBDCUTVRJW-BHYZAODMSA-N |
| XLogP | 8.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|