C12H14O2 — CID 57457859
2-(methoxymethoxy)-1,1a,6,6a-tetrahydrocyclopropa[a]indene (PubChem CID 57457859) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-(methoxymethoxy)-1,1a,6,6a-tetrahydrocyclopropa[a]indene.
| Compound Name | 2-(methoxymethoxy)-1,1a,6,6a-tetrahydrocyclopropa[a]indene |
|---|---|
| PubChem CID | 57457859 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-(methoxymethoxy)-1,1a,6,6a-tetrahydrocyclopropa[a]indene |
| SMILES | COCOc1cccc2c1C1CC1C2 |
| InChI | InChI=1S/C12H14O2/c1-13-7-14-11-4-2-3-8-5-9-6-10(9)12(8)11/h2-4,9-10H,5-7H2,1H3 |
| InChIKey | APRNRCQWMRQHLQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|