C14H16N2O — CID 15662355
2-(8-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)acetonitrile (PubChem CID 15662355) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-(8-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)acetonitrile.
| Compound Name | 2-(8-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 15662355 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-(8-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)acetonitrile |
| SMILES | COc1cccc2c1C1CN(CC#N)CC1C2 |
| InChI | InChI=1S/C14H16N2O/c1-17-13-4-2-3-10-7-11-8-16(6-5-15)9-12(11)14(10)13/h2-4,11-12H,6-9H2,1H3 |
| InChIKey | CYLMSASBGKKABH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|