C22H26ClFN2O2 — CID 67754305
N-[2-[(4aS,9aR)-5-methoxy-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridin-2-yl]ethyl]-4-fluorobenzamide;hydrochloride (PubChem CID 67754305) has the molecular formula C22H26ClFN2O2 and a molecular weight of 404.91 g/mol. Its IUPAC name is N-[2-[(4aS,9aR)-5-methoxy-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridin-2-yl]ethyl]-4-fluorobenzamide;hydrochloride.
| Compound Name | N-[2-[(4aS,9aR)-5-methoxy-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridin-2-yl]ethyl]-4-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 67754305 |
| Molecular Formula | C22H26ClFN2O2 |
| Molecular Weight | 404.91 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[2-[(4aS,9aR)-5-methoxy-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridin-2-yl]ethyl]-4-fluorobenzamide;hydrochloride |
| SMILES | COc1cccc2c1[C@H]1CCN(CCNC(=O)c3ccc(F)cc3)C[C@@H]1C2.Cl |
| InChI | InChI=1S/C22H25FN2O2.ClH/c1-27-20-4-2-3-16-13-17-14-25(11-9-19(17)21(16)20)12-10-24-22(26)15-5-7-18(23)8-6-15;/h2-8,17,19H,9-14H2,1H3,(H,24,26);1H/t17-,19-;/m0./s1 |
| InChIKey | KZQZFWPKJXJTSR-QQTWVUFVSA-N |
| XLogP | 3.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.91 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |