C22H26FN3O3 — CID 29207413
N-[2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]ethyl]-4-methoxybenzamide (PubChem CID 29207413) has the molecular formula C22H26FN3O3 and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 29207413 |
| Molecular Formula | C22H26FN3O3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCN2CCN(C(=O)Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H26FN3O3/c1-29-20-8-4-18(5-9-20)22(28)24-10-11-25-12-14-26(15-13-25)21(27)16-17-2-6-19(23)7-3-17/h2-9H,10-16H2,1H3,(H,24,28) |
| InChIKey | VDSQPKPRXKWCMP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |