C19H30N4O4 — CID 119883434
4-methoxy-N-[2-[4-[2-(2-methoxyethylamino)acetyl]piperazin-1-yl]ethyl]benzamide (PubChem CID 119883434) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-methoxy-N-[2-[4-[2-(2-methoxyethylamino)acetyl]piperazin-1-yl]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[4-[2-(2-methoxyethylamino)acetyl]piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 119883434 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 4-methoxy-N-[2-[4-[2-(2-methoxyethylamino)acetyl]piperazin-1-yl]ethyl]benzamide |
| SMILES | COCCNCC(=O)N1CCN(CCNC(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C19H30N4O4/c1-26-14-8-20-15-18(24)23-12-10-22(11-13-23)9-7-21-19(25)16-3-5-17(27-2)6-4-16/h3-6,20H,7-15H2,1-2H3,(H,21,25) |
| InChIKey | PBPMTIZILABMFB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|