C17H26ClN3O4 — CID 119727506
1-[4-(3-methoxybenzoyl)piperazin-1-yl]-2-(2-methoxyethylamino)ethanone;hydrochloride (PubChem CID 119727506) has the molecular formula C17H26ClN3O4 and a molecular weight of 371.87 g/mol. Its IUPAC name is 1-[4-(3-methoxybenzoyl)piperazin-1-yl]-2-(2-methoxyethylamino)ethanone;hydrochloride.
| Compound Name | 1-[4-(3-methoxybenzoyl)piperazin-1-yl]-2-(2-methoxyethylamino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119727506 |
| Molecular Formula | C17H26ClN3O4 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[4-(3-methoxybenzoyl)piperazin-1-yl]-2-(2-methoxyethylamino)ethanone;hydrochloride |
| SMILES | COCCNCC(=O)N1CCN(C(=O)c2cccc(OC)c2)CC1.Cl |
| InChI | InChI=1S/C17H25N3O4.ClH/c1-23-11-6-18-13-16(21)19-7-9-20(10-8-19)17(22)14-4-3-5-15(12-14)24-2;/h3-5,12,18H,6-11,13H2,1-2H3;1H |
| InChIKey | FRSQGAMSUXEXAN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|