C16H27Cl2N3O3 — CID 119829459
2-(2-methoxyethylamino)-1-[4-(3-methoxyphenyl)piperazin-1-yl]ethanone;dihydrochloride (PubChem CID 119829459) has the molecular formula C16H27Cl2N3O3 and a molecular weight of 380.32 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-1-[4-(3-methoxyphenyl)piperazin-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-1-[4-(3-methoxyphenyl)piperazin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119829459 |
| Molecular Formula | C16H27Cl2N3O3 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-(2-methoxyethylamino)-1-[4-(3-methoxyphenyl)piperazin-1-yl]ethanone;dihydrochloride |
| SMILES | COCCNCC(=O)N1CCN(c2cccc(OC)c2)CC1.Cl.Cl |
| InChI | InChI=1S/C16H25N3O3.2ClH/c1-21-11-6-17-13-16(20)19-9-7-18(8-10-19)14-4-3-5-15(12-14)22-2;;/h3-5,12,17H,6-11,13H2,1-2H3;2*1H |
| InChIKey | LKSCYIFKFHNFBB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|