C16H22ClF2N3O3 — CID 119771193
1-[4-(2,4-difluorobenzoyl)piperazin-1-yl]-2-(2-methoxyethylamino)ethanone;hydrochloride (PubChem CID 119771193) has the molecular formula C16H22ClF2N3O3 and a molecular weight of 377.82 g/mol. Its IUPAC name is 1-[4-(2,4-difluorobenzoyl)piperazin-1-yl]-2-(2-methoxyethylamino)ethanone;hydrochloride.
| Compound Name | 1-[4-(2,4-difluorobenzoyl)piperazin-1-yl]-2-(2-methoxyethylamino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119771193 |
| Molecular Formula | C16H22ClF2N3O3 |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-[4-(2,4-difluorobenzoyl)piperazin-1-yl]-2-(2-methoxyethylamino)ethanone;hydrochloride |
| SMILES | COCCNCC(=O)N1CCN(C(=O)c2ccc(F)cc2F)CC1.Cl |
| InChI | InChI=1S/C16H21F2N3O3.ClH/c1-24-9-4-19-11-15(22)20-5-7-21(8-6-20)16(23)13-3-2-12(17)10-14(13)18;/h2-3,10,19H,4-9,11H2,1H3;1H |
| InChIKey | ASOGMUHOLBKHDW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|