C17H26Cl2FN3O3 — CID 119837006
1-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-(2-methoxyethylamino)ethanone;dihydrochloride (PubChem CID 119837006) has the molecular formula C17H26Cl2FN3O3 and a molecular weight of 410.32 g/mol. Its IUPAC name is 1-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-(2-methoxyethylamino)ethanone;dihydrochloride.
| Compound Name | 1-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-(2-methoxyethylamino)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119837006 |
| Molecular Formula | C17H26Cl2FN3O3 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-(2-methoxyethylamino)ethanone;dihydrochloride |
| SMILES | COCCNCC(=O)N1CCN(c2ccc(C(C)=O)cc2F)CC1.Cl.Cl |
| InChI | InChI=1S/C17H24FN3O3.2ClH/c1-13(22)14-3-4-16(15(18)11-14)20-6-8-21(9-7-20)17(23)12-19-5-10-24-2;;/h3-4,11,19H,5-10,12H2,1-2H3;2*1H |
| InChIKey | UFZJZAAVYZLDBV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|