C17H24FN3O3 — CID 17407851
4-(4-acetyl-2-fluorophenyl)-N-(3-methoxypropyl)piperazine-1-carboxamide (PubChem CID 17407851) has the molecular formula C17H24FN3O3 and a molecular weight of 337.40 g/mol. Its IUPAC name is 4-(4-acetyl-2-fluorophenyl)-N-(3-methoxypropyl)piperazine-1-carboxamide.
| Compound Name | 4-(4-acetyl-2-fluorophenyl)-N-(3-methoxypropyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 17407851 |
| Molecular Formula | C17H24FN3O3 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 4-(4-acetyl-2-fluorophenyl)-N-(3-methoxypropyl)piperazine-1-carboxamide |
| SMILES | COCCCNC(=O)N1CCN(c2ccc(C(C)=O)cc2F)CC1 |
| InChI | InChI=1S/C17H24FN3O3/c1-13(22)14-4-5-16(15(18)12-14)20-7-9-21(10-8-20)17(23)19-6-3-11-24-2/h4-5,12H,3,6-11H2,1-2H3,(H,19,23) |
| InChIKey | VWMOAGOOMRPLTH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|