C26H34FN5O2 — CID 112837390
4-(4-acetyl-2-fluorophenyl)-N-[3-(4-phenylpiperazin-1-yl)propyl]piperazine-1-carboxamide (PubChem CID 112837390) has the molecular formula C26H34FN5O2 and a molecular weight of 467.59 g/mol. Its IUPAC name is 4-(4-acetyl-2-fluorophenyl)-N-[3-(4-phenylpiperazin-1-yl)propyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-acetyl-2-fluorophenyl)-N-[3-(4-phenylpiperazin-1-yl)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112837390 |
| Molecular Formula | C26H34FN5O2 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 4-(4-acetyl-2-fluorophenyl)-N-[3-(4-phenylpiperazin-1-yl)propyl]piperazine-1-carboxamide |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)NCCCN3CCN(c4ccccc4)CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C26H34FN5O2/c1-21(33)22-8-9-25(24(27)20-22)31-16-18-32(19-17-31)26(34)28-10-5-11-29-12-14-30(15-13-29)23-6-3-2-4-7-23/h2-4,6-9,20H,5,10-19H2,1H3,(H,28,34) |
| InChIKey | OBFLWNUSPBFEPS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|