C21H20BrFN2O4 — CID 41165083
[2-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-bromobenzoate (PubChem CID 41165083) has the molecular formula C21H20BrFN2O4 and a molecular weight of 463.30 g/mol. Its IUPAC name is [2-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-bromobenzoate.
| Compound Name | [2-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 41165083 |
| Molecular Formula | C21H20BrFN2O4 |
| Molecular Weight | 463.30 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | [2-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-bromobenzoate |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)COC(=O)c3ccc(Br)cc3)CC2)c(F)c1 |
| InChI | InChI=1S/C21H20BrFN2O4/c1-14(26)16-4-7-19(18(23)12-16)24-8-10-25(11-9-24)20(27)13-29-21(28)15-2-5-17(22)6-3-15/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | GJJLORXKIWQLFT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |