C22H22F2N2O5 — CID 55467929
[2-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(4-fluorophenoxy)acetate (PubChem CID 55467929) has the molecular formula C22H22F2N2O5 and a molecular weight of 432.42 g/mol. Its IUPAC name is [2-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(4-fluorophenoxy)acetate.
| Compound Name | [2-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 55467929 |
| Molecular Formula | C22H22F2N2O5 |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [2-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)COC(=O)COc3ccc(F)cc3)CC2)c(F)c1 |
| InChI | InChI=1S/C22H22F2N2O5/c1-15(27)16-2-7-20(19(24)12-16)25-8-10-26(11-9-25)21(28)13-31-22(29)14-30-18-5-3-17(23)4-6-18/h2-7,12H,8-11,13-14H2,1H3 |
| InChIKey | JBQWWPOSWLJMSR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |