C23H21Cl2FN2O4 — CID 46668878
[2-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 46668878) has the molecular formula C23H21Cl2FN2O4 and a molecular weight of 479.34 g/mol. Its IUPAC name is [2-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46668878 |
| Molecular Formula | C23H21Cl2FN2O4 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | [2-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)COC(=O)/C=C/c3ccc(Cl)c(Cl)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C23H21Cl2FN2O4/c1-15(29)17-4-6-21(20(26)13-17)27-8-10-28(11-9-27)22(30)14-32-23(31)7-3-16-2-5-18(24)19(25)12-16/h2-7,12-13H,8-11,14H2,1H3/b7-3+ |
| InChIKey | PDNHGLQLEOFOFH-XVNBXDOJSA-N |
| XLogP | 4.24 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|