C29H34N2O3 — CID 10027192
(1S,7R)-4-[4-[(4aS,9aR)-5-methoxy-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridin-2-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione (PubChem CID 10027192) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is (1S,7R)-4-[4-[(4aS,9aR)-5-methoxy-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridin-2-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione.
| Compound Name | (1S,7R)-4-[4-[(4aS,9aR)-5-methoxy-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridin-2-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
|---|---|
| PubChem CID | 10027192 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (1S,7R)-4-[4-[(4aS,9aR)-5-methoxy-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridin-2-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
| SMILES | COc1cccc2c1[C@H]1CCN(CCCCN3C(=O)C4C(C3=O)[C@H]3C=C[C@@H]4C4C=CC43)C[C@@H]1C2 |
| InChI | InChI=1S/C29H34N2O3/c1-34-24-6-4-5-17-15-18-16-30(14-11-19(18)25(17)24)12-2-3-13-31-28(32)26-22-9-10-23(27(26)29(31)33)21-8-7-20(21)22/h4-10,18-23,26-27H,2-3,11-16H2,1H3/t18-,19-,20?,21?,22-,23+,26?,27?/m0/s1 |
| InChIKey | JFLJSOJGVKQKJH-ITXQOMLZSA-N |
| XLogP | 3.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|