C16H19NO3 — CID 10061844
(4aR,9aR)-5-methoxy-2-propyl-4,4a,9,9a-tetrahydroindeno[2,1-c]pyridine-1,3-dione (PubChem CID 10061844) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (4aR,9aR)-5-methoxy-2-propyl-4,4a,9,9a-tetrahydroindeno[2,1-c]pyridine-1,3-dione.
| Compound Name | (4aR,9aR)-5-methoxy-2-propyl-4,4a,9,9a-tetrahydroindeno[2,1-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 10061844 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (4aR,9aR)-5-methoxy-2-propyl-4,4a,9,9a-tetrahydroindeno[2,1-c]pyridine-1,3-dione |
| SMILES | CCCN1C(=O)C[C@H]2c3c(cccc3OC)C[C@H]2C1=O |
| InChI | InChI=1S/C16H19NO3/c1-3-7-17-14(18)9-11-12(16(17)19)8-10-5-4-6-13(20-2)15(10)11/h4-6,11-12H,3,7-9H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | SGGNZTQBLKOLGT-VXGBXAGGSA-N |
| XLogP | 2.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|