C20H23NO — CID 14975313
(4aS,9aR)-2-benzyl-5-methoxy-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridine (PubChem CID 14975313) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (4aS,9aR)-2-benzyl-5-methoxy-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridine.
| Compound Name | (4aS,9aR)-2-benzyl-5-methoxy-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 14975313 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (4aS,9aR)-2-benzyl-5-methoxy-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridine |
| SMILES | COc1cccc2c1[C@H]1CCN(Cc3ccccc3)C[C@@H]1C2 |
| InChI | InChI=1S/C20H23NO/c1-22-19-9-5-8-16-12-17-14-21(11-10-18(17)20(16)19)13-15-6-3-2-4-7-15/h2-9,17-18H,10-14H2,1H3/t17-,18-/m0/s1 |
| InChIKey | KXYSZXCAUCZVKZ-ROUUACIJSA-N |
| XLogP | 3.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |