C19H23NO2 — CID 124500714
(2R)-1-benzyl-2-(2,6-dimethoxyphenyl)pyrrolidine (PubChem CID 124500714) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2R)-1-benzyl-2-(2,6-dimethoxyphenyl)pyrrolidine.
| Compound Name | (2R)-1-benzyl-2-(2,6-dimethoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 124500714 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2R)-1-benzyl-2-(2,6-dimethoxyphenyl)pyrrolidine |
| SMILES | COc1cccc(OC)c1[C@H]1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-21-17-11-6-12-18(22-2)19(17)16-10-7-13-20(16)14-15-8-4-3-5-9-15/h3-6,8-9,11-12,16H,7,10,13-14H2,1-2H3/t16-/m1/s1 |
| InChIKey | CYYZASICFWQTOO-MRXNPFEDSA-N |
| XLogP | 4.04 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |