C26H30N2O — CID 54178989
(2R,3R)-1-benzyl-N-[(2-methoxyphenyl)methyl]-2-phenylpiperidin-3-amine (PubChem CID 54178989) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is (2R,3R)-1-benzyl-N-[(2-methoxyphenyl)methyl]-2-phenylpiperidin-3-amine.
| Compound Name | (2R,3R)-1-benzyl-N-[(2-methoxyphenyl)methyl]-2-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 54178989 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (2R,3R)-1-benzyl-N-[(2-methoxyphenyl)methyl]-2-phenylpiperidin-3-amine |
| SMILES | COc1ccccc1CN[C@@H]1CCCN(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H30N2O/c1-29-25-17-9-8-15-23(25)19-27-24-16-10-18-28(20-21-11-4-2-5-12-21)26(24)22-13-6-3-7-14-22/h2-9,11-15,17,24,26-27H,10,16,18-20H2,1H3/t24-,26-/m1/s1 |
| InChIKey | PALPVEDAGGOYPX-AOYPEHQESA-N |
| XLogP | 5.19 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |