C25H34N2O3 — CID 57301973
6-[(2S,3S)-3-[(2-methoxyphenyl)methylamino]-2-phenylpiperidin-1-yl]hexanoic acid (PubChem CID 57301973) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is 6-[(2S,3S)-3-[(2-methoxyphenyl)methylamino]-2-phenylpiperidin-1-yl]hexanoic acid.
| Compound Name | 6-[(2S,3S)-3-[(2-methoxyphenyl)methylamino]-2-phenylpiperidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 57301973 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 6-[(2S,3S)-3-[(2-methoxyphenyl)methylamino]-2-phenylpiperidin-1-yl]hexanoic acid |
| SMILES | COc1ccccc1CN[C@H]1CCCN(CCCCCC(=O)O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H34N2O3/c1-30-23-15-8-7-13-21(23)19-26-22-14-10-18-27(17-9-3-6-16-24(28)29)25(22)20-11-4-2-5-12-20/h2,4-5,7-8,11-13,15,22,25-26H,3,6,9-10,14,16-19H2,1H3,(H,28,29)/t22-,25-/m0/s1 |
| InChIKey | AESAYLQDZGDCBB-DHLKQENFSA-N |
| XLogP | 4.64 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|