C20H23NO — CID 10062998
(3aS,9aS)-1-benzyl-5-methoxy-2,3,3a,4,9,9a-hexahydrobenzo[f]indole (PubChem CID 10062998) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (3aS,9aS)-1-benzyl-5-methoxy-2,3,3a,4,9,9a-hexahydrobenzo[f]indole.
| Compound Name | (3aS,9aS)-1-benzyl-5-methoxy-2,3,3a,4,9,9a-hexahydrobenzo[f]indole |
|---|---|
| PubChem CID | 10062998 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (3aS,9aS)-1-benzyl-5-methoxy-2,3,3a,4,9,9a-hexahydrobenzo[f]indole |
| SMILES | COc1cccc2c1C[C@H]1CCN(Cc3ccccc3)[C@H]1C2 |
| InChI | InChI=1S/C20H23NO/c1-22-20-9-5-8-16-13-19-17(12-18(16)20)10-11-21(19)14-15-6-3-2-4-7-15/h2-9,17,19H,10-14H2,1H3/t17-,19+/m1/s1 |
| InChIKey | SRCYZESDHGJOSG-MJGOQNOKSA-N |
| XLogP | 3.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |