C19H21N — CID 54235385
(3aR,9aR)-1-benzyl-2,3,3a,4,9,9a-hexahydrobenzo[f]indole (PubChem CID 54235385) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is (3aR,9aR)-1-benzyl-2,3,3a,4,9,9a-hexahydrobenzo[f]indole.
| Compound Name | (3aR,9aR)-1-benzyl-2,3,3a,4,9,9a-hexahydrobenzo[f]indole |
|---|---|
| PubChem CID | 54235385 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (3aR,9aR)-1-benzyl-2,3,3a,4,9,9a-hexahydrobenzo[f]indole |
| SMILES | c1ccc(CN2CC[C@H]3Cc4ccccc4C[C@H]32)cc1 |
| InChI | InChI=1S/C19H21N/c1-2-6-15(7-3-1)14-20-11-10-18-12-16-8-4-5-9-17(16)13-19(18)20/h1-9,18-19H,10-14H2/t18-,19+/m0/s1 |
| InChIKey | QMEXOSWCCOVWRA-RBUKOAKNSA-N |
| XLogP | 3.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |