C20H24N2S — CID 156507348
(4aS,7aR)-1,4-dibenzyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine (PubChem CID 156507348) has the molecular formula C20H24N2S and a molecular weight of 324.49 g/mol. Its IUPAC name is (4aS,7aR)-1,4-dibenzyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine.
| Compound Name | (4aS,7aR)-1,4-dibenzyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine |
|---|---|
| PubChem CID | 156507348 |
| Molecular Formula | C20H24N2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (4aS,7aR)-1,4-dibenzyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine |
| SMILES | c1ccc(CN2CCN(Cc3ccccc3)[C@H]3CSC[C@H]32)cc1 |
| InChI | InChI=1S/C20H24N2S/c1-3-7-17(8-4-1)13-21-11-12-22(20-16-23-15-19(20)21)14-18-9-5-2-6-10-18/h1-10,19-20H,11-16H2/t19-,20+ |
| InChIKey | XBRCDWIYVKRGPE-BGYRXZFFSA-N |
| XLogP | 3.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |