C22H27N — CID 18717968
(3aR,7aR)-1,5-dibenzyl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 18717968) has the molecular formula C22H27N and a molecular weight of 305.47 g/mol. Its IUPAC name is (3aR,7aR)-1,5-dibenzyl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | (3aR,7aR)-1,5-dibenzyl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 18717968 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (3aR,7aR)-1,5-dibenzyl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | c1ccc(CC2CC[C@@H]3[C@@H](CCN3Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H27N/c1-3-7-18(8-4-1)15-20-11-12-22-21(16-20)13-14-23(22)17-19-9-5-2-6-10-19/h1-10,20-22H,11-17H2/t20?,21-,22+/m0/s1 |
| InChIKey | MZYBUBSQTXTTNM-JTGIGXABSA-N |
| XLogP | 4.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |