C13H18N2 — CID 67234366
(1R,4R,7R)-2-benzyl-2-azabicyclo[2.2.1]heptan-7-amine (PubChem CID 67234366) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (1R,4R,7R)-2-benzyl-2-azabicyclo[2.2.1]heptan-7-amine.
| Compound Name | (1R,4R,7R)-2-benzyl-2-azabicyclo[2.2.1]heptan-7-amine |
|---|---|
| PubChem CID | 67234366 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (1R,4R,7R)-2-benzyl-2-azabicyclo[2.2.1]heptan-7-amine |
| SMILES | N[C@@H]1[C@@H]2CC[C@H]1N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C13H18N2/c14-13-11-6-7-12(13)15(9-11)8-10-4-2-1-3-5-10/h1-5,11-13H,6-9,14H2/t11-,12-,13-/m1/s1 |
| InChIKey | RLVKNSFGRHNZJI-JHJVBQTASA-N |
| XLogP | 1.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |