C12H14IN — CID 44519577
(1R,4R,5R)-2-benzyl-5-iodo-2-azabicyclo[2.1.1]hexane (PubChem CID 44519577) has the molecular formula C12H14IN and a molecular weight of 299.15 g/mol. Its IUPAC name is (1R,4R,5R)-2-benzyl-5-iodo-2-azabicyclo[2.1.1]hexane.
| Compound Name | (1R,4R,5R)-2-benzyl-5-iodo-2-azabicyclo[2.1.1]hexane |
|---|---|
| PubChem CID | 44519577 |
| Molecular Formula | C12H14IN |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | (1R,4R,5R)-2-benzyl-5-iodo-2-azabicyclo[2.1.1]hexane |
| SMILES | I[C@@H]1[C@@H]2C[C@H]1N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C12H14IN/c13-12-10-6-11(12)14(8-10)7-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2/t10-,11-,12-/m1/s1 |
| InChIKey | KDDUXDOFESMLMQ-IJLUTSLNSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|