C12H14N4 — CID 44519573
(1R,4R,5R)-5-azido-2-benzyl-2-azabicyclo[2.1.1]hexane (PubChem CID 44519573) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is (1R,4R,5R)-5-azido-2-benzyl-2-azabicyclo[2.1.1]hexane.
| Compound Name | (1R,4R,5R)-5-azido-2-benzyl-2-azabicyclo[2.1.1]hexane |
|---|---|
| PubChem CID | 44519573 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (1R,4R,5R)-5-azido-2-benzyl-2-azabicyclo[2.1.1]hexane |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H]2C[C@H]1N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C12H14N4/c13-15-14-12-10-6-11(12)16(8-10)7-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2/t10-,11-,12-/m1/s1 |
| InChIKey | ZUCHSWBDRMCRKO-IJLUTSLNSA-N |
| XLogP | 2.57 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|