C12H16N2 — CID 83669976
6-benzyl-3,6-diazabicyclo[3.2.0]heptane (PubChem CID 83669976) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 6-benzyl-3,6-diazabicyclo[3.2.0]heptane.
| Compound Name | 6-benzyl-3,6-diazabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 83669976 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 6-benzyl-3,6-diazabicyclo[3.2.0]heptane |
| SMILES | c1ccc(CN2CC3CNCC32)cc1 |
| InChI | InChI=1S/C12H16N2/c1-2-4-10(5-3-1)8-14-9-11-6-13-7-12(11)14/h1-5,11-13H,6-9H2 |
| InChIKey | WXHTUKYZIRAUKQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |