C19H22N2 — CID 134073287
3,6-dibenzyl-3,6-diazabicyclo[3.2.0]heptane (PubChem CID 134073287) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 3,6-dibenzyl-3,6-diazabicyclo[3.2.0]heptane.
| Compound Name | 3,6-dibenzyl-3,6-diazabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 134073287 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 3,6-dibenzyl-3,6-diazabicyclo[3.2.0]heptane |
| SMILES | c1ccc(CN2CC3CN(Cc4ccccc4)C3C2)cc1 |
| InChI | InChI=1S/C19H22N2/c1-3-7-16(8-4-1)11-20-13-18-14-21(19(18)15-20)12-17-9-5-2-6-10-17/h1-10,18-19H,11-15H2 |
| InChIKey | DRQFTHPKYZUHKT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |