C13H18N2O — CID 57017760
(3aR,6S,6aR)-4-benzyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-6-amine (PubChem CID 57017760) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is (3aR,6S,6aR)-4-benzyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-6-amine.
| Compound Name | (3aR,6S,6aR)-4-benzyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-6-amine |
|---|---|
| PubChem CID | 57017760 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (3aR,6S,6aR)-4-benzyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-6-amine |
| SMILES | N[C@H]1CN(Cc2ccccc2)[C@@H]2CCO[C@@H]21 |
| InChI | InChI=1S/C13H18N2O/c14-11-9-15(12-6-7-16-13(11)12)8-10-4-2-1-3-5-10/h1-5,11-13H,6-9,14H2/t11-,12+,13+/m0/s1 |
| InChIKey | ZVZQRSMDNOMGTL-YNEHKIRRSA-N |
| XLogP | 0.99 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |