C16H24N2O — CID 90405473
(3R,4S)-1-benzyl-4-(oxan-2-yl)pyrrolidin-3-amine (PubChem CID 90405473) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-4-(oxan-2-yl)pyrrolidin-3-amine.
| Compound Name | (3R,4S)-1-benzyl-4-(oxan-2-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 90405473 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (3R,4S)-1-benzyl-4-(oxan-2-yl)pyrrolidin-3-amine |
| SMILES | N[C@H]1CN(Cc2ccccc2)C[C@@H]1C1CCCCO1 |
| InChI | InChI=1S/C16H24N2O/c17-15-12-18(10-13-6-2-1-3-7-13)11-14(15)16-8-4-5-9-19-16/h1-3,6-7,14-16H,4-5,8-12,17H2/t14-,15-,16?/m0/s1 |
| InChIKey | IZMCMZQESIQXER-KSCSMHSMSA-N |
| XLogP | 2.01 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |