C16H22N2O3 — CID 124677092
(3S,4R)-1-benzyl-3-nitro-4-[(2R)-oxan-2-yl]pyrrolidine (PubChem CID 124677092) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-3-nitro-4-[(2R)-oxan-2-yl]pyrrolidine.
| Compound Name | (3S,4R)-1-benzyl-3-nitro-4-[(2R)-oxan-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 124677092 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (3S,4R)-1-benzyl-3-nitro-4-[(2R)-oxan-2-yl]pyrrolidine |
| SMILES | O=[N+]([O-])[C@@H]1CN(Cc2ccccc2)C[C@H]1[C@H]1CCCCO1 |
| InChI | InChI=1S/C16H22N2O3/c19-18(20)15-12-17(10-13-6-2-1-3-7-13)11-14(15)16-8-4-5-9-21-16/h1-3,6-7,14-16H,4-5,8-12H2/t14-,15-,16-/m1/s1 |
| InChIKey | GHIHKEOYKYFRNI-BZUAXINKSA-N |
| XLogP | 2.33 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|