C15H19NO — CID 72622975
2-benzyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole (PubChem CID 72622975) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-benzyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole.
| Compound Name | 2-benzyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole |
|---|---|
| PubChem CID | 72622975 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-benzyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole |
| SMILES | c1ccc(CN2CC3C4CCC(O4)C3C2)cc1 |
| InChI | InChI=1S/C15H19NO/c1-2-4-11(5-3-1)8-16-9-12-13(10-16)15-7-6-14(12)17-15/h1-5,12-15H,6-10H2 |
| InChIKey | IMEMNKMJTAVQHI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |