C16H19N — CID 15223361
4-benzyl-4-azatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 15223361) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is 4-benzyl-4-azatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | 4-benzyl-4-azatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 15223361 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 4-benzyl-4-azatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | C1=CC2CC1C1CN(Cc3ccccc3)CC21 |
| InChI | InChI=1S/C16H19N/c1-2-4-12(5-3-1)9-17-10-15-13-6-7-14(8-13)16(15)11-17/h1-7,13-16H,8-11H2 |
| InChIKey | WDLADEJGVJTTSA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|