C22H24N2 — CID 139065758
(1S,2R,6S,7R)-3,5-dibenzyl-3,5-diazatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 139065758) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (1S,2R,6S,7R)-3,5-dibenzyl-3,5-diazatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (1S,2R,6S,7R)-3,5-dibenzyl-3,5-diazatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 139065758 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (1S,2R,6S,7R)-3,5-dibenzyl-3,5-diazatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | C1=C[C@H]2C[C@@H]1[C@@H]1[C@H]2N(Cc2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C22H24N2/c1-3-7-17(8-4-1)14-23-16-24(15-18-9-5-2-6-10-18)22-20-12-11-19(13-20)21(22)23/h1-12,19-22H,13-16H2/t19-,20+,21-,22+ |
| InChIKey | UUVSEYRIZSHMSO-COPRSSIGSA-N |
| XLogP | 3.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|