C12H17BrN2 — CID 141204982
(1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.1]heptane;hydrobromide (PubChem CID 141204982) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.1]heptane;hydrobromide.
| Compound Name | (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.1]heptane;hydrobromide |
|---|---|
| PubChem CID | 141204982 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.1]heptane;hydrobromide |
| SMILES | Br.c1ccc(CN2C[C@@H]3C[C@H]2CN3)cc1 |
| InChI | InChI=1S/C12H16N2.BrH/c1-2-4-10(5-3-1)8-14-9-11-6-12(14)7-13-11;/h1-5,11-13H,6-9H2;1H/t11-,12-;/m0./s1 |
| InChIKey | JVIXTBADBCXMOH-FXMYHANSSA-N |
| XLogP | 1.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |