C17H17NO2 — CID 13307148
(3aS,9aS)-2-benzyl-1,3,3a,9a-tetrahydro-[1,4]benzodioxino[2,3-c]pyrrole (PubChem CID 13307148) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (3aS,9aS)-2-benzyl-1,3,3a,9a-tetrahydro-[1,4]benzodioxino[2,3-c]pyrrole.
| Compound Name | (3aS,9aS)-2-benzyl-1,3,3a,9a-tetrahydro-[1,4]benzodioxino[2,3-c]pyrrole |
|---|---|
| PubChem CID | 13307148 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (3aS,9aS)-2-benzyl-1,3,3a,9a-tetrahydro-[1,4]benzodioxino[2,3-c]pyrrole |
| SMILES | c1ccc(CN2C[C@@H]3Oc4ccccc4O[C@H]3C2)cc1 |
| InChI | InChI=1S/C17H17NO2/c1-2-6-13(7-3-1)10-18-11-16-17(12-18)20-15-9-5-4-8-14(15)19-16/h1-9,16-17H,10-12H2/t16-,17-/m0/s1 |
| InChIKey | RJWCQVDZKIFSQH-IRXDYDNUSA-N |
| XLogP | 2.71 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |