C17H17ClFNO2 — CID 67880524
(3aR,9aR)-2-benzyl-5-fluoro-1,3,3a,9a-tetrahydro-[1,4]benzodioxino[2,3-c]pyrrole;hydrochloride (PubChem CID 67880524) has the molecular formula C17H17ClFNO2 and a molecular weight of 321.78 g/mol. Its IUPAC name is (3aR,9aR)-2-benzyl-5-fluoro-1,3,3a,9a-tetrahydro-[1,4]benzodioxino[2,3-c]pyrrole;hydrochloride.
| Compound Name | (3aR,9aR)-2-benzyl-5-fluoro-1,3,3a,9a-tetrahydro-[1,4]benzodioxino[2,3-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 67880524 |
| Molecular Formula | C17H17ClFNO2 |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | (3aR,9aR)-2-benzyl-5-fluoro-1,3,3a,9a-tetrahydro-[1,4]benzodioxino[2,3-c]pyrrole;hydrochloride |
| SMILES | Cl.Fc1cccc2c1O[C@@H]1CN(Cc3ccccc3)C[C@H]1O2 |
| InChI | InChI=1S/C17H16FNO2.ClH/c18-13-7-4-8-14-17(13)21-16-11-19(10-15(16)20-14)9-12-5-2-1-3-6-12;/h1-8,15-16H,9-11H2;1H/t15-,16-;/m1./s1 |
| InChIKey | HWJXQTSANLQNJK-QNBGGDODSA-N |
| XLogP | 3.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |