C18H19NO2 — CID 10378994
(4aR,10aR)-2-benzyl-3,4,4a,10a-tetrahydro-1H-[1,4]benzodioxino[3,2-c]pyridine (PubChem CID 10378994) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (4aR,10aR)-2-benzyl-3,4,4a,10a-tetrahydro-1H-[1,4]benzodioxino[3,2-c]pyridine.
| Compound Name | (4aR,10aR)-2-benzyl-3,4,4a,10a-tetrahydro-1H-[1,4]benzodioxino[3,2-c]pyridine |
|---|---|
| PubChem CID | 10378994 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (4aR,10aR)-2-benzyl-3,4,4a,10a-tetrahydro-1H-[1,4]benzodioxino[3,2-c]pyridine |
| SMILES | c1ccc(CN2CC[C@H]3Oc4ccccc4O[C@@H]3C2)cc1 |
| InChI | InChI=1S/C18H19NO2/c1-2-6-14(7-3-1)12-19-11-10-17-18(13-19)21-16-9-5-4-8-15(16)20-17/h1-9,17-18H,10-13H2/t17-,18-/m1/s1 |
| InChIKey | SGVWSFYUIOFGDB-QZTJIDSGSA-N |
| XLogP | 3.10 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |