C18H20N2O2 — CID 66940986
(3R,4S)-1-benzyl-3-(2-methylphenyl)-4-nitropyrrolidine (PubChem CID 66940986) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-3-(2-methylphenyl)-4-nitropyrrolidine.
| Compound Name | (3R,4S)-1-benzyl-3-(2-methylphenyl)-4-nitropyrrolidine |
|---|---|
| PubChem CID | 66940986 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (3R,4S)-1-benzyl-3-(2-methylphenyl)-4-nitropyrrolidine |
| SMILES | Cc1ccccc1[C@@H]1CN(Cc2ccccc2)C[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N2O2/c1-14-7-5-6-10-16(14)17-12-19(13-18(17)20(21)22)11-15-8-3-2-4-9-15/h2-10,17-18H,11-13H2,1H3/t17-,18+/m0/s1 |
| InChIKey | QBFJVQZMAWYXNS-ZWKOTPCHSA-N |
| XLogP | 3.24 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|