C12H13F3N2O2 — CID 51777252
(3S,4R)-1-benzyl-3-nitro-4-(trifluoromethyl)pyrrolidine (PubChem CID 51777252) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-3-nitro-4-(trifluoromethyl)pyrrolidine.
| Compound Name | (3S,4R)-1-benzyl-3-nitro-4-(trifluoromethyl)pyrrolidine |
|---|---|
| PubChem CID | 51777252 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (3S,4R)-1-benzyl-3-nitro-4-(trifluoromethyl)pyrrolidine |
| SMILES | O=[N+]([O-])[C@@H]1CN(Cc2ccccc2)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O2/c13-12(14,15)10-7-16(8-11(10)17(18)19)6-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11-/m1/s1 |
| InChIKey | DPEGQJIXKNZUDJ-GHMZBOCLSA-N |
| XLogP | 2.33 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|