C14H20N2O4 — CID 90406724
(3R,4R)-1-benzyl-3-(dimethoxymethyl)-4-nitropyrrolidine (PubChem CID 90406724) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-3-(dimethoxymethyl)-4-nitropyrrolidine.
| Compound Name | (3R,4R)-1-benzyl-3-(dimethoxymethyl)-4-nitropyrrolidine |
|---|---|
| PubChem CID | 90406724 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (3R,4R)-1-benzyl-3-(dimethoxymethyl)-4-nitropyrrolidine |
| SMILES | COC(OC)[C@@H]1CN(Cc2ccccc2)C[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N2O4/c1-19-14(20-2)12-9-15(10-13(12)16(17)18)8-11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | ZLDQPHQBJSXYNN-OLZOCXBDSA-N |
| XLogP | 1.38 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|