C17H17FN2O2 — CID 10447515
(3S,4R)-1-benzyl-3-(4-fluorophenyl)-4-nitropyrrolidine (PubChem CID 10447515) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-3-(4-fluorophenyl)-4-nitropyrrolidine.
| Compound Name | (3S,4R)-1-benzyl-3-(4-fluorophenyl)-4-nitropyrrolidine |
|---|---|
| PubChem CID | 10447515 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (3S,4R)-1-benzyl-3-(4-fluorophenyl)-4-nitropyrrolidine |
| SMILES | O=[N+]([O-])[C@H]1CN(Cc2ccccc2)C[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN2O2/c18-15-8-6-14(7-9-15)16-11-19(12-17(16)20(21)22)10-13-4-2-1-3-5-13/h1-9,16-17H,10-12H2/t16-,17+/m1/s1 |
| InChIKey | YCDZWQNDXSITIX-SJORKVTESA-N |
| XLogP | 3.07 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|