C17H23NO2 — CID 176650201
methyl (2S,4R)-1-benzyl-2-cyclopropylpiperidine-4-carboxylate (PubChem CID 176650201) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is methyl (2S,4R)-1-benzyl-2-cyclopropylpiperidine-4-carboxylate.
| Compound Name | methyl (2S,4R)-1-benzyl-2-cyclopropylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 176650201 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | methyl (2S,4R)-1-benzyl-2-cyclopropylpiperidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CCN(Cc2ccccc2)[C@H](C2CC2)C1 |
| InChI | InChI=1S/C17H23NO2/c1-20-17(19)15-9-10-18(16(11-15)14-7-8-14)12-13-5-3-2-4-6-13/h2-6,14-16H,7-12H2,1H3/t15-,16+/m1/s1 |
| InChIKey | GVMZJHAUTKWIQN-CVEARBPZSA-N |
| XLogP | 2.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |