C13H17NO3 — CID 57385727
methyl (2S,3S)-1-benzyl-3-hydroxypyrrolidine-2-carboxylate (PubChem CID 57385727) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is methyl (2S,3S)-1-benzyl-3-hydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3S)-1-benzyl-3-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57385727 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | methyl (2S,3S)-1-benzyl-3-hydroxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](O)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c1-17-13(16)12-11(15)7-8-14(12)9-10-5-3-2-4-6-10/h2-6,11-12,15H,7-9H2,1H3/t11-,12-/m0/s1 |
| InChIKey | WYIRVTOUIPMAMG-RYUDHWBXSA-N |
| XLogP | 0.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |