C14H18N4O2 — CID 122535010
methyl (2S,3S)-3-(azidomethyl)-1-benzylpyrrolidine-2-carboxylate (PubChem CID 122535010) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is methyl (2S,3S)-3-(azidomethyl)-1-benzylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3S)-3-(azidomethyl)-1-benzylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 122535010 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl (2S,3S)-3-(azidomethyl)-1-benzylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](CN=[N+]=[N-])CCN1Cc1ccccc1 |
| InChI | InChI=1S/C14H18N4O2/c1-20-14(19)13-12(9-16-17-15)7-8-18(13)10-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3/t12-,13-/m0/s1 |
| InChIKey | KASLVKGMDOFSEL-STQMWFEESA-N |
| XLogP | 2.36 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|