C17H24ClNO — CID 67768848
(4aS,10aS)-9-methoxy-1-prop-2-enyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline;hydrochloride (PubChem CID 67768848) has the molecular formula C17H24ClNO and a molecular weight of 293.84 g/mol. Its IUPAC name is (4aS,10aS)-9-methoxy-1-prop-2-enyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline;hydrochloride.
| Compound Name | (4aS,10aS)-9-methoxy-1-prop-2-enyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline;hydrochloride |
|---|---|
| PubChem CID | 67768848 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (4aS,10aS)-9-methoxy-1-prop-2-enyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline;hydrochloride |
| SMILES | C=CCN1CCC[C@H]2Cc3cccc(OC)c3C[C@@H]21.Cl |
| InChI | InChI=1S/C17H23NO.ClH/c1-3-9-18-10-5-7-14-11-13-6-4-8-17(19-2)15(13)12-16(14)18;/h3-4,6,8,14,16H,1,5,7,9-12H2,2H3;1H/t14-,16-;/m0./s1 |
| InChIKey | YYLCXKNWVDVJRP-DMLYUBSXSA-N |
| XLogP | 3.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|